C14H19BrClNO — CID 63712784
5-bromo-2-(chloromethyl)-N-methyl-N-(oxan-3-ylmethyl)aniline (PubChem CID 63712784) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-N-methyl-N-(oxan-3-ylmethyl)aniline.
| Compound Name | 5-bromo-2-(chloromethyl)-N-methyl-N-(oxan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 63712784 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-N-methyl-N-(oxan-3-ylmethyl)aniline |
| SMILES | CN(CC1CCCOC1)c1cc(Br)ccc1CCl |
| InChI | InChI=1S/C14H19BrClNO/c1-17(9-11-3-2-6-18-10-11)14-7-13(15)5-4-12(14)8-16/h4-5,7,11H,2-3,6,8-10H2,1H3 |
| InChIKey | VRFUKFVHKRWDEE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|