About [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate
[(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 6371364) has the molecular formula C12H13F3N2O3S3
and a molecular weight of 386.44 g/mol. Its IUPAC name is [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 6371364 |
| Molecular Formula | C12H13F3N2O3S3 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | N/C(=N/OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C1CSCCS1 |
| InChI | InChI=1S/C12H13F3N2O3S3/c13-12(14,15)8-1-3-9(4-2-8)23(18,19)20-17-11(16)10-7-21-5-6-22-10/h1-4,10H,5-7H2,(H2,16,17) |
| InChIKey | JUZNYKUVVBXULG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate (CID 6371364) is [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate is N/C(=N/OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C1CSCCS1.
What is the InChIKey of [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is JUZNYKUVVBXULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2O3S3/c13-12(14,15)8-1-3-9(4-2-8)23(18,19)20-17-11(16)10-7-21-5-6-22-10/h1-4,10H,5-7H2,(H2,16,17).
What are the key properties of [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate?
[(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 386.44 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[amino(1,4-dithian-2-yl)methylidene]amino] 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 6371364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).