About (2S)-2-chlorobutane
(2S)-2-chlorobutane (PubChem CID 637146) has the molecular formula C4H9Cl
and a molecular weight of 92.57 g/mol. Its IUPAC name is (2S)-2-chlorobutane.
Molecular Properties
| Compound Name | (2S)-2-chlorobutane |
| PubChem CID | 637146 |
| Molecular Formula | C4H9Cl |
| Molecular Weight | 92.57 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | (2S)-2-chlorobutane |
| SMILES | CC[C@H](C)Cl |
| InChI | InChI=1S/C4H9Cl/c1-3-4(2)5/h4H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | BSPCSKHALVHRSR-BYPYZUCNSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-chlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-chlorobutane?
The IUPAC name of (2S)-2-chlorobutane (CID 637146) is (2S)-2-chlorobutane.
What is the SMILES notation for (2S)-2-chlorobutane?
The canonical SMILES for (2S)-2-chlorobutane is CC[C@H](C)Cl.
What is the InChIKey of (2S)-2-chlorobutane?
The InChIKey is BSPCSKHALVHRSR-BYPYZUCNSA-N. The full InChI is InChI=1S/C4H9Cl/c1-3-4(2)5/h4H,3H2,1-2H3/t4-/m0/s1.
What are the key properties of (2S)-2-chlorobutane?
(2S)-2-chlorobutane has a molecular weight of 92.57 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-chlorobutane is sourced from PubChem (CID 637146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).