C14H18Cl2N2O — CID 63714822
N-[1-(3,4-dichlorophenyl)ethyl]-4-methylpyrrolidine-3-carboxamide (PubChem CID 63714822) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-4-methylpyrrolidine-3-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63714822 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-4-methylpyrrolidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CNCC1C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-8-6-17-7-11(8)14(19)18-9(2)10-3-4-12(15)13(16)5-10/h3-5,8-9,11,17H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | IBBIQAJAHKKRES-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |