About N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide
N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide (PubChem CID 63714914) has the molecular formula C12H13BrCl2N2O
and a molecular weight of 352.06 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide |
| PubChem CID | 63714914 |
| Molecular Formula | C12H13BrCl2N2O |
| Molecular Weight | 352.06 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide |
| SMILES | CC1CNCC1C(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H13BrCl2N2O/c1-6-4-16-5-8(6)12(18)17-11-9(14)2-7(13)3-10(11)15/h2-3,6,8,16H,4-5H2,1H3,(H,17,18) |
| InChIKey | CFWZEPFBFSODID-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.06 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide?
The IUPAC name of N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide (CID 63714914) is N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide.
What is the SMILES notation for N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide?
The canonical SMILES for N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide is CC1CNCC1C(=O)Nc1c(Cl)cc(Br)cc1Cl.
What is the InChIKey of N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide?
The InChIKey is CFWZEPFBFSODID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrCl2N2O/c1-6-4-16-5-8(6)12(18)17-11-9(14)2-7(13)3-10(11)15/h2-3,6,8,16H,4-5H2,1H3,(H,17,18).
What are the key properties of N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide?
N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide has a molecular weight of 352.06 g/mol, XLogP of 3.55, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-dichlorophenyl)-4-methylpyrrolidine-3-carboxamide is sourced from PubChem (CID 63714914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).