C12H14FN3O4 — CID 63715060
(2S)-4-amino-2-[(4-fluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 63715060) has the molecular formula C12H14FN3O4 and a molecular weight of 283.26 g/mol. Its IUPAC name is (2S)-4-amino-2-[(4-fluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(4-fluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63715060 |
| Molecular Formula | C12H14FN3O4 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2S)-4-amino-2-[(4-fluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)NCc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C12H14FN3O4/c13-8-3-1-7(2-4-8)6-15-12(20)16-9(11(18)19)5-10(14)17/h1-4,9H,5-6H2,(H2,14,17)(H,18,19)(H2,15,16,20)/t9-/m0/s1 |
| InChIKey | STSPATLYXPBMHW-VIFPVBQESA-N |
| XLogP | -0.05 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |