C4H6Cl4 — CID 637154
(2S,3S)-1,2,3,4-tetrachlorobutane (PubChem CID 637154) has the molecular formula C4H6Cl4 and a molecular weight of 195.90 g/mol. Its IUPAC name is (2S,3S)-1,2,3,4-tetrachlorobutane.
| Compound Name | (2S,3S)-1,2,3,4-tetrachlorobutane |
|---|---|
| PubChem CID | 637154 |
| Molecular Formula | C4H6Cl4 |
| Molecular Weight | 195.90 g/mol |
| Exact Mass | 193.92 |
| IUPAC Name | (2S,3S)-1,2,3,4-tetrachlorobutane |
| SMILES | ClC[C@H](Cl)[C@@H](Cl)CCl |
| InChI | InChI=1S/C4H6Cl4/c5-1-3(7)4(8)2-6/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | IXZVKECRTHXEEW-IMJSIDKUSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.90 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|