C8H5F6N3O2 — CID 6371635
2-cyano-N-[(E)-(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]acetamide (PubChem CID 6371635) has the molecular formula C8H5F6N3O2 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-cyano-N-[(E)-(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]acetamide.
| Compound Name | 2-cyano-N-[(E)-(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 6371635 |
| Molecular Formula | C8H5F6N3O2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-cyano-N-[(E)-(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]acetamide |
| SMILES | N#CCC(=O)N/N=C(\CC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H5F6N3O2/c9-7(10,11)4(3-5(18)8(12,13)14)16-17-6(19)1-2-15/h1,3H2,(H,17,19)/b16-4+ |
| InChIKey | HQKDNFHOTSKGTA-AYSLTRBKSA-N |
| XLogP | 1.46 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|