C19H24O4 — CID 637166
(2R)-2-[(E,4R,6R)-4,6-dihydroxy-8-phenyloct-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 637166) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R)-2-[(E,4R,6R)-4,6-dihydroxy-8-phenyloct-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E,4R,6R)-4,6-dihydroxy-8-phenyloct-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 637166 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2R)-2-[(E,4R,6R)-4,6-dihydroxy-8-phenyloct-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CC[C@H](/C=C/C[C@@H](O)C[C@H](O)CCc2ccccc2)O1 |
| InChI | InChI=1S/C19H24O4/c20-16(8-4-9-18-10-5-11-19(22)23-18)14-17(21)13-12-15-6-2-1-3-7-15/h1-7,9,11,16-18,20-21H,8,10,12-14H2/b9-4+/t16-,17-,18+/m1/s1 |
| InChIKey | QSFJVCDVSIBMCG-CMFXGKTQSA-N |
| XLogP | 2.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|