About 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine
1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 63716691) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine |
| PubChem CID | 63716691 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CCC(C)c1n[nH]c(C(C)N)n1 |
| InChI | InChI=1S/C8H16N4/c1-4-5(2)7-10-8(6(3)9)12-11-7/h5-6H,4,9H2,1-3H3,(H,10,11,12) |
| InChIKey | BGBBOYOXJQCQHL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine?
The IUPAC name of 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine (CID 63716691) is 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine.
What is the SMILES notation for 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine?
The canonical SMILES for 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine is CCC(C)c1n[nH]c(C(C)N)n1.
What is the InChIKey of 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine?
The InChIKey is BGBBOYOXJQCQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-4-5(2)7-10-8(6(3)9)12-11-7/h5-6H,4,9H2,1-3H3,(H,10,11,12).
What are the key properties of 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine?
1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine has a molecular weight of 168.24 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine is sourced from PubChem (CID 63716691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).