About 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine
3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine (PubChem CID 63717621) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 63717621 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCNc1nc(C(C)CC)no1 |
| InChI | InChI=1S/C8H15N3O/c1-4-6(3)7-10-8(9-5-2)12-11-7/h6H,4-5H2,1-3H3,(H,9,10,11) |
| InChIKey | VQSQUMREXLAOAC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine (CID 63717621) is 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine is CCNc1nc(C(C)CC)no1.
What is the InChIKey of 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine?
The InChIKey is VQSQUMREXLAOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-4-6(3)7-10-8(9-5-2)12-11-7/h6H,4-5H2,1-3H3,(H,9,10,11).
What are the key properties of 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine?
3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine has a molecular weight of 169.23 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-N-ethyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 63717621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).