About 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine
1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine (PubChem CID 63718090) has the molecular formula C6H8N6S
and a molecular weight of 196.24 g/mol. Its IUPAC name is 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine |
| PubChem CID | 63718090 |
| Molecular Formula | C6H8N6S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine |
| SMILES | Cn1nnnc1NCc1cscn1 |
| InChI | InChI=1S/C6H8N6S/c1-12-6(9-10-11-12)7-2-5-3-13-4-8-5/h3-4H,2H2,1H3,(H,7,9,11) |
| InChIKey | DIAQCQMNOZRDQR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine?
The IUPAC name of 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine (CID 63718090) is 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine.
What is the SMILES notation for 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine?
The canonical SMILES for 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine is Cn1nnnc1NCc1cscn1.
What is the InChIKey of 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine?
The InChIKey is DIAQCQMNOZRDQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6S/c1-12-6(9-10-11-12)7-2-5-3-13-4-8-5/h3-4H,2H2,1H3,(H,7,9,11).
What are the key properties of 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine?
1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine has a molecular weight of 196.24 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(1,3-thiazol-4-ylmethyl)tetrazol-5-amine is sourced from PubChem (CID 63718090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).