C11H7N5O — CID 63718638
5-cyano-N,N-bis(cyanomethyl)pyridine-2-carboxamide (PubChem CID 63718638) has the molecular formula C11H7N5O and a molecular weight of 225.21 g/mol. Its IUPAC name is 5-cyano-N,N-bis(cyanomethyl)pyridine-2-carboxamide.
| Compound Name | 5-cyano-N,N-bis(cyanomethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63718638 |
| Molecular Formula | C11H7N5O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 5-cyano-N,N-bis(cyanomethyl)pyridine-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C11H7N5O/c12-3-5-16(6-4-13)11(17)10-2-1-9(7-14)8-15-10/h1-2,8H,5-6H2 |
| InChIKey | SLDOSPBYBVQNDX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 104.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|