C14H18ClN3O3 — CID 63720121
1-[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 63720121) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 1-[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63720121 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1CN(C(=O)CN(C)c2ccc(Cl)cn2)CC1C(=O)O |
| InChI | InChI=1S/C14H18ClN3O3/c1-9-6-18(7-11(9)14(20)21)13(19)8-17(2)12-4-3-10(15)5-16-12/h3-5,9,11H,6-8H2,1-2H3,(H,20,21) |
| InChIKey | XPRPHFPZWFPFEZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |