C14H17ClN2O3 — CID 63720544
1-[2-(3-chloroanilino)-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 63720544) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 1-[2-(3-chloroanilino)-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(3-chloroanilino)-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63720544 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-[2-(3-chloroanilino)-2-oxoethyl]-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1CN(CC(=O)Nc2cccc(Cl)c2)CC1C(=O)O |
| InChI | InChI=1S/C14H17ClN2O3/c1-9-6-17(7-12(9)14(19)20)8-13(18)16-11-4-2-3-10(15)5-11/h2-5,9,12H,6-8H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | ZXNRECLWHYSFCT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |