About 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid
1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 63721041) has the molecular formula C11H19NO6S2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid |
| PubChem CID | 63721041 |
| Molecular Formula | C11H19NO6S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1CN(S(=O)(=O)C2CCS(=O)(=O)CC2)CC1C(=O)O |
| InChI | InChI=1S/C11H19NO6S2/c1-8-6-12(7-10(8)11(13)14)20(17,18)9-2-4-19(15,16)5-3-9/h8-10H,2-7H2,1H3,(H,13,14) |
| InChIKey | MSHGOKDFOMACNX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid (CID 63721041) is 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid is CC1CN(S(=O)(=O)C2CCS(=O)(=O)CC2)CC1C(=O)O.
What is the InChIKey of 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid?
The InChIKey is MSHGOKDFOMACNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO6S2/c1-8-6-12(7-10(8)11(13)14)20(17,18)9-2-4-19(15,16)5-3-9/h8-10H,2-7H2,1H3,(H,13,14).
What are the key properties of 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid?
1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid has a molecular weight of 325.41 g/mol, XLogP of -0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-4-yl)sulfonyl-4-methylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63721041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).