C22H36O3 — CID 637218
[(4aR,5S,6R,8aS)-5-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate (PubChem CID 637218) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is [(4aR,5S,6R,8aS)-5-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [(4aR,5S,6R,8aS)-5-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 637218 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | [(4aR,5S,6R,8aS)-5-[(3S)-3-hydroxy-3-methylpent-4-enyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES | C=C[C@@](C)(O)CC[C@@]1(C)[C@H](C)CC[C@]2(C)C(COC(C)=O)=CCC[C@H]12 |
| InChI | InChI=1S/C22H36O3/c1-7-20(4,24)13-14-21(5)16(2)11-12-22(6)18(15-25-17(3)23)9-8-10-19(21)22/h7,9,16,19,24H,1,8,10-15H2,2-6H3/t16-,19-,20-,21+,22-/m1/s1 |
| InChIKey | HMSAXXCDLFKNRA-CNPJFBIHSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|