About (2E)-1-chloro-3,7-dimethylocta-2,6-diene
(2E)-1-chloro-3,7-dimethylocta-2,6-diene (PubChem CID 6372219) has the molecular formula C10H17Cl
and a molecular weight of 172.70 g/mol. Its IUPAC name is (2E)-1-chloro-3,7-dimethylocta-2,6-diene.
Molecular Properties
| Compound Name | (2E)-1-chloro-3,7-dimethylocta-2,6-diene |
| PubChem CID | 6372219 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (2E)-1-chloro-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CCl |
| InChI | InChI=1S/C10H17Cl/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | WLAUCMCTKPXDIY-JXMROGBWSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-chloro-3,7-dimethylocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-chloro-3,7-dimethylocta-2,6-diene?
The IUPAC name of (2E)-1-chloro-3,7-dimethylocta-2,6-diene (CID 6372219) is (2E)-1-chloro-3,7-dimethylocta-2,6-diene.
What is the SMILES notation for (2E)-1-chloro-3,7-dimethylocta-2,6-diene?
The canonical SMILES for (2E)-1-chloro-3,7-dimethylocta-2,6-diene is CC(C)=CCC/C(C)=C/CCl.
What is the InChIKey of (2E)-1-chloro-3,7-dimethylocta-2,6-diene?
The InChIKey is WLAUCMCTKPXDIY-JXMROGBWSA-N. The full InChI is InChI=1S/C10H17Cl/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+.
What are the key properties of (2E)-1-chloro-3,7-dimethylocta-2,6-diene?
(2E)-1-chloro-3,7-dimethylocta-2,6-diene has a molecular weight of 172.70 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-chloro-3,7-dimethylocta-2,6-diene is sourced from PubChem (CID 6372219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).