About 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine
2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 63722653) has the molecular formula C14H14N4
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 63722653 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(-c2nc3nccc(C)c3[nH]2)c(C)n1 |
| InChI | InChI=1S/C14H14N4/c1-8-6-7-15-14-12(8)17-13(18-14)11-5-4-9(2)16-10(11)3/h4-7H,1-3H3,(H,15,17,18) |
| InChIKey | MYSDVYNCHLBCII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine (CID 63722653) is 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine is Cc1ccc(-c2nc3nccc(C)c3[nH]2)c(C)n1.
What is the InChIKey of 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine?
The InChIKey is MYSDVYNCHLBCII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4/c1-8-6-7-15-14-12(8)17-13(18-14)11-5-4-9(2)16-10(11)3/h4-7H,1-3H3,(H,15,17,18).
What are the key properties of 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine?
2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine has a molecular weight of 238.29 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethyl-3-pyridinyl)-7-methyl-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 63722653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).