About 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine
1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine (PubChem CID 63722977) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine |
| PubChem CID | 63722977 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine |
| SMILES | CCC(N)c1nc2nccc(C)c2[nH]1 |
| InChI | InChI=1S/C10H14N4/c1-3-7(11)9-13-8-6(2)4-5-12-10(8)14-9/h4-5,7H,3,11H2,1-2H3,(H,12,13,14) |
| InChIKey | BTNYDRUSBPDCEA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine?
The IUPAC name of 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine (CID 63722977) is 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine.
What is the SMILES notation for 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine?
The canonical SMILES for 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine is CCC(N)c1nc2nccc(C)c2[nH]1.
What is the InChIKey of 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine?
The InChIKey is BTNYDRUSBPDCEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-3-7(11)9-13-8-6(2)4-5-12-10(8)14-9/h4-5,7H,3,11H2,1-2H3,(H,12,13,14).
What are the key properties of 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine?
1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine has a molecular weight of 190.25 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)propan-1-amine is sourced from PubChem (CID 63722977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).