About 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline
4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline (PubChem CID 63723648) has the molecular formula C13H11ClN4
and a molecular weight of 258.71 g/mol. Its IUPAC name is 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline.
Molecular Properties
| Compound Name | 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
| PubChem CID | 63723648 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
| SMILES | Cc1ccnc2nc(-c3cc(Cl)ccc3N)[nH]c12 |
| InChI | InChI=1S/C13H11ClN4/c1-7-4-5-16-13-11(7)17-12(18-13)9-6-8(14)2-3-10(9)15/h2-6H,15H2,1H3,(H,16,17,18) |
| InChIKey | RINLDZAWBCPVOU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
The IUPAC name of 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline (CID 63723648) is 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline.
What is the SMILES notation for 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
The canonical SMILES for 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline is Cc1ccnc2nc(-c3cc(Cl)ccc3N)[nH]c12.
What is the InChIKey of 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
The InChIKey is RINLDZAWBCPVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4/c1-7-4-5-16-13-11(7)17-12(18-13)9-6-8(14)2-3-10(9)15/h2-6H,15H2,1H3,(H,16,17,18).
What are the key properties of 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline has a molecular weight of 258.71 g/mol, XLogP of 3.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline is sourced from PubChem (CID 63723648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).