About 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid
2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid (PubChem CID 63724627) has the molecular formula C11H8ClN3O4
and a molecular weight of 281.66 g/mol. Its IUPAC name is 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid |
| PubChem CID | 63724627 |
| Molecular Formula | C11H8ClN3O4 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1cccc(Cl)c1C(=O)O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H8ClN3O4/c12-5-2-1-3-6(8(5)10(17)18)14-9(16)7-4-13-11(19)15-7/h1-4H,(H,14,16)(H,17,18)(H2,13,15,19) |
| InChIKey | AGBPIKPIVIKVGQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid?
The IUPAC name of 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid (CID 63724627) is 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid.
What is the SMILES notation for 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid?
The canonical SMILES for 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid is O=C(Nc1cccc(Cl)c1C(=O)O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid?
The InChIKey is AGBPIKPIVIKVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O4/c12-5-2-1-3-6(8(5)10(17)18)14-9(16)7-4-13-11(19)15-7/h1-4H,(H,14,16)(H,17,18)(H2,13,15,19).
What are the key properties of 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid?
2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid has a molecular weight of 281.66 g/mol, XLogP of 1.31, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoic acid is sourced from PubChem (CID 63724627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).