C13H18N4O2 — CID 63724885
1-[5-(aminomethyl)pyridine-2-carbonyl]piperidine-3-carboxamide (PubChem CID 63724885) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[5-(aminomethyl)pyridine-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-(aminomethyl)pyridine-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63724885 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-[5-(aminomethyl)pyridine-2-carbonyl]piperidine-3-carboxamide |
| SMILES | NCc1ccc(C(=O)N2CCCC(C(N)=O)C2)nc1 |
| InChI | InChI=1S/C13H18N4O2/c14-6-9-3-4-11(16-7-9)13(19)17-5-1-2-10(8-17)12(15)18/h3-4,7,10H,1-2,5-6,8,14H2,(H2,15,18) |
| InChIKey | PXARTKNJUYSTRN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |