C15H27N3 — CID 63726698
N'-[2-(benzylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 63726698) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N'-[2-(benzylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[2-(benzylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63726698 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N'-[2-(benzylamino)ethyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)CCNCc1ccccc1 |
| InChI | InChI=1S/C15H27N3/c1-17(2)11-7-12-18(3)13-10-16-14-15-8-5-4-6-9-15/h4-6,8-9,16H,7,10-14H2,1-3H3 |
| InChIKey | IYIWYUFHTYLSBH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|