C27H27N5O5S — CID 6372743
N-[(Z)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6372743) has the molecular formula C27H27N5O5S and a molecular weight of 533.61 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6372743 |
| Molecular Formula | C27H27N5O5S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | N-[(Z)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc(-c2nnc(SCC(=O)N/N=C\C(C)=C\c3ccco3)n2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H27N5O5S/c1-18(13-21-11-8-12-37-21)16-28-29-24(33)17-38-27-31-30-26(32(27)20-9-6-5-7-10-20)19-14-22(34-2)25(36-4)23(15-19)35-3/h5-16H,17H2,1-4H3,(H,29,33)/b18-13+,28-16- |
| InChIKey | YFNRJZUIOXBQHV-CRUDXKJNSA-N |
| XLogP | 4.85 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|