About 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol
2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol (PubChem CID 63728022) has the molecular formula C12H20ClN3O
and a molecular weight of 257.76 g/mol. Its IUPAC name is 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol.
Molecular Properties
| Compound Name | 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol |
| PubChem CID | 63728022 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)Nc1nc(C)nc(Cl)c1C |
| InChI | InChI=1S/C12H20ClN3O/c1-5-12(6-2,7-17)16-11-8(3)10(13)14-9(4)15-11/h17H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | IHICBIJHGYHRNN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol?
The IUPAC name of 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol (CID 63728022) is 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol.
What is the SMILES notation for 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol?
The canonical SMILES for 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol is CCC(CC)(CO)Nc1nc(C)nc(Cl)c1C.
What is the InChIKey of 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol?
The InChIKey is IHICBIJHGYHRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3O/c1-5-12(6-2,7-17)16-11-8(3)10(13)14-9(4)15-11/h17H,5-7H2,1-4H3,(H,14,15,16).
What are the key properties of 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol?
2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol has a molecular weight of 257.76 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-ethylbutan-1-ol is sourced from PubChem (CID 63728022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).