About (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone
(2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone (PubChem CID 6373041) has the molecular formula C15H14N2O
and a molecular weight of 238.29 g/mol. Its IUPAC name is (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone.
Molecular Properties
| Compound Name | (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone |
| PubChem CID | 6373041 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone |
| SMILES | CN/N=C(/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O/c1-16-17-14(12-8-4-2-5-9-12)15(18)13-10-6-3-7-11-13/h2-11,16H,1H3/b17-14+ |
| InChIKey | FHXQDYMEZCTRGK-SAPNQHFASA-N |
| XLogP | 2.49 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone?
The IUPAC name of (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone (CID 6373041) is (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone.
What is the SMILES notation for (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone?
The canonical SMILES for (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone is CN/N=C(/C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone?
The InChIKey is FHXQDYMEZCTRGK-SAPNQHFASA-N. The full InChI is InChI=1S/C15H14N2O/c1-16-17-14(12-8-4-2-5-9-12)15(18)13-10-6-3-7-11-13/h2-11,16H,1H3/b17-14+.
What are the key properties of (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone?
(2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone has a molecular weight of 238.29 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(methylhydrazinylidene)-1,2-diphenylethanone is sourced from PubChem (CID 6373041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).