C19H20O2 — CID 63730810
(4-butan-2-ylphenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanone (PubChem CID 63730810) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanone.
| Compound Name | (4-butan-2-ylphenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanone |
|---|---|
| PubChem CID | 63730810 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (4-butan-2-ylphenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanone |
| SMILES | CCC(C)c1ccc(C(=O)c2ccc3c(c2)COC3)cc1 |
| InChI | InChI=1S/C19H20O2/c1-3-13(2)14-4-6-15(7-5-14)19(20)16-8-9-17-11-21-12-18(17)10-16/h4-10,13H,3,11-12H2,1-2H3 |
| InChIKey | IEGCETIJGSUHIU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |