methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate

C9H11ClN2O2S — CID 63733521

IUPACmethyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate
SMILESCOC(=O)CSc1nc(C)nc(Cl)c1C
InChIInChI=1S/C9H11ClN2O2S/c1-5-8(10)11-6(2)12-9(5)15-4-7(13)14-3/h4H2,1-3H3
InChIKeyMWGWBJXOMXODDC-UHFFFAOYSA-N
MW246.72 g/mol
LogP2.01
Rot. Bonds3

About methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate

methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate (PubChem CID 63733521) has the molecular formula C9H11ClN2O2S and a molecular weight of 246.72 g/mol. Its IUPAC name is methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate.

Molecular Properties

Compound Namemethyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate
PubChem CID63733521
Molecular FormulaC9H11ClN2O2S
Molecular Weight246.72 g/mol
Exact Mass246.02
IUPAC Namemethyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate
SMILESCOC(=O)CSc1nc(C)nc(Cl)c1C
InChIInChI=1S/C9H11ClN2O2S/c1-5-8(10)11-6(2)12-9(5)15-4-7(13)14-3/h4H2,1-3H3
InChIKeyMWGWBJXOMXODDC-UHFFFAOYSA-N
XLogP2.01
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.72
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate?
The IUPAC name of methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate (CID 63733521) is methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate is COC(=O)CSc1nc(C)nc(Cl)c1C.
What is the InChIKey of methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate?
The InChIKey is MWGWBJXOMXODDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O2S/c1-5-8(10)11-6(2)12-9(5)15-4-7(13)14-3/h4H2,1-3H3.
What are the key properties of methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate?
methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate has a molecular weight of 246.72 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-chloro-2,5-dimethylpyrimidin-4-yl)sulfanylacetate is sourced from PubChem (CID 63733521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).