C15H22F2N2 — CID 63734627
2-(difluoromethyl)-1-N-methyl-1-N-(2-methylcyclohexyl)benzene-1,4-diamine (PubChem CID 63734627) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-methyl-1-N-(2-methylcyclohexyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-methyl-1-N-(2-methylcyclohexyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63734627 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-(difluoromethyl)-1-N-methyl-1-N-(2-methylcyclohexyl)benzene-1,4-diamine |
| SMILES | CC1CCCCC1N(C)c1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C15H22F2N2/c1-10-5-3-4-6-13(10)19(2)14-8-7-11(18)9-12(14)15(16)17/h7-10,13,15H,3-6,18H2,1-2H3 |
| InChIKey | VMNDOMUAMQJYCS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|