About 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one
4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one (PubChem CID 63734938) has the molecular formula C10H13ClN4O
and a molecular weight of 240.69 g/mol. Its IUPAC name is 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one |
| PubChem CID | 63734938 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one |
| SMILES | Cc1nc(Cl)c(C)c(N2CCNC(=O)C2)n1 |
| InChI | InChI=1S/C10H13ClN4O/c1-6-9(11)13-7(2)14-10(6)15-4-3-12-8(16)5-15/h3-5H2,1-2H3,(H,12,16) |
| InChIKey | JOQKAWBOBODZPT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one?
The IUPAC name of 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one (CID 63734938) is 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one.
What is the SMILES notation for 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one?
The canonical SMILES for 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one is Cc1nc(Cl)c(C)c(N2CCNC(=O)C2)n1.
What is the InChIKey of 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one?
The InChIKey is JOQKAWBOBODZPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4O/c1-6-9(11)13-7(2)14-10(6)15-4-3-12-8(16)5-15/h3-5H2,1-2H3,(H,12,16).
What are the key properties of 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one?
4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one has a molecular weight of 240.69 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)piperazin-2-one is sourced from PubChem (CID 63734938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).