About N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine
N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine (PubChem CID 63735248) has the molecular formula C10H16ClN3
and a molecular weight of 213.71 g/mol. Its IUPAC name is N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine |
| PubChem CID | 63735248 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(C)c(NC(C)(C)C)n1 |
| InChI | InChI=1S/C10H16ClN3/c1-6-8(11)12-7(2)13-9(6)14-10(3,4)5/h1-5H3,(H,12,13,14) |
| InChIKey | KVISFUWVSBRFBC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine?
The IUPAC name of N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine (CID 63735248) is N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine.
What is the SMILES notation for N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine?
The canonical SMILES for N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine is Cc1nc(Cl)c(C)c(NC(C)(C)C)n1.
What is the InChIKey of N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine?
The InChIKey is KVISFUWVSBRFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3/c1-6-8(11)12-7(2)13-9(6)14-10(3,4)5/h1-5H3,(H,12,13,14).
What are the key properties of N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine?
N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine has a molecular weight of 213.71 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-6-chloro-2,5-dimethylpyrimidin-4-amine is sourced from PubChem (CID 63735248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).