About 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine
4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine (PubChem CID 63735529) has the molecular formula C9H13ClN2O2
and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine |
| PubChem CID | 63735529 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine |
| SMILES | COCCOc1nc(C)nc(Cl)c1C |
| InChI | InChI=1S/C9H13ClN2O2/c1-6-8(10)11-7(2)12-9(6)14-5-4-13-3/h4-5H2,1-3H3 |
| InChIKey | ZCOPFPLJQVTFPD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine?
The IUPAC name of 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine (CID 63735529) is 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine.
What is the SMILES notation for 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine?
The canonical SMILES for 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine is COCCOc1nc(C)nc(Cl)c1C.
What is the InChIKey of 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine?
The InChIKey is ZCOPFPLJQVTFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O2/c1-6-8(10)11-7(2)12-9(6)14-5-4-13-3/h4-5H2,1-3H3.
What are the key properties of 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine?
4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine has a molecular weight of 216.67 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(2-methoxyethoxy)-2,5-dimethylpyrimidine is sourced from PubChem (CID 63735529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).