C13H11Cl3N2O — CID 63735554
4-chloro-6-(2,4-dichlorophenoxy)-5-propylpyrimidine (PubChem CID 63735554) has the molecular formula C13H11Cl3N2O and a molecular weight of 317.60 g/mol. Its IUPAC name is 4-chloro-6-(2,4-dichlorophenoxy)-5-propylpyrimidine.
| Compound Name | 4-chloro-6-(2,4-dichlorophenoxy)-5-propylpyrimidine |
|---|---|
| PubChem CID | 63735554 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 4-chloro-6-(2,4-dichlorophenoxy)-5-propylpyrimidine |
| SMILES | CCCc1c(Cl)ncnc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2O/c1-2-3-9-12(16)17-7-18-13(9)19-11-5-4-8(14)6-10(11)15/h4-7H,2-3H2,1H3 |
| InChIKey | SMPSIQJDTXBFKA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |