About (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine
(6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine (PubChem CID 63735591) has the molecular formula C6H9ClN4
and a molecular weight of 172.62 g/mol. Its IUPAC name is (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine |
| PubChem CID | 63735591 |
| Molecular Formula | C6H9ClN4 |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine |
| SMILES | Cc1nc(Cl)c(C)c(NN)n1 |
| InChI | InChI=1S/C6H9ClN4/c1-3-5(7)9-4(2)10-6(3)11-8/h8H2,1-2H3,(H,9,10,11) |
| InChIKey | VHOUIJPEINQDSA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine?
The IUPAC name of (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine (CID 63735591) is (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine.
What is the SMILES notation for (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine?
The canonical SMILES for (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine is Cc1nc(Cl)c(C)c(NN)n1.
What is the InChIKey of (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine?
The InChIKey is VHOUIJPEINQDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN4/c1-3-5(7)9-4(2)10-6(3)11-8/h8H2,1-2H3,(H,9,10,11).
What are the key properties of (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine?
(6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine has a molecular weight of 172.62 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-2,5-dimethylpyrimidin-4-yl)hydrazine is sourced from PubChem (CID 63735591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).