About [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate
[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate (PubChem CID 6373579) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate |
| PubChem CID | 6373579 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C2\CC3CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-12-5-7-13(8-6-12)16(20)21-19-15-11-14-9-10-18(15,4)17(14,2)3/h5-8,14H,9-11H2,1-4H3/b19-15+ |
| InChIKey | NXAITCVPAUWQJG-XDJHFCHBSA-N |
| XLogP | 4.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate?
The IUPAC name of [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate (CID 6373579) is [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate.
What is the SMILES notation for [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate?
The canonical SMILES for [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate is Cc1ccc(C(=O)O/N=C2\CC3CCC2(C)C3(C)C)cc1.
What is the InChIKey of [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate?
The InChIKey is NXAITCVPAUWQJG-XDJHFCHBSA-N. The full InChI is InChI=1S/C18H23NO2/c1-12-5-7-13(8-6-12)16(20)21-19-15-11-14-9-10-18(15,4)17(14,2)3/h5-8,14H,9-11H2,1-4H3/b19-15+.
What are the key properties of [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate?
[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate has a molecular weight of 285.39 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-methylbenzoate is sourced from PubChem (CID 6373579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).