C11H8Cl2FN3 — CID 63736084
6-chloro-N-(2-chloro-4-fluorophenyl)-5-methylpyrimidin-4-amine (PubChem CID 63736084) has the molecular formula C11H8Cl2FN3 and a molecular weight of 272.11 g/mol. Its IUPAC name is 6-chloro-N-(2-chloro-4-fluorophenyl)-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-chloro-4-fluorophenyl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63736084 |
| Molecular Formula | C11H8Cl2FN3 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 6-chloro-N-(2-chloro-4-fluorophenyl)-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)ncnc1Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H8Cl2FN3/c1-6-10(13)15-5-16-11(6)17-9-3-2-7(14)4-8(9)12/h2-5H,1H3,(H,15,16,17) |
| InChIKey | JGMUFCOZEVHCMF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |