C11H12F2N4 — CID 63736361
3-(difluoromethyl)-4-(3,5-dimethyl-1,2,4-triazol-1-yl)aniline (PubChem CID 63736361) has the molecular formula C11H12F2N4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(3,5-dimethyl-1,2,4-triazol-1-yl)aniline.
| Compound Name | 3-(difluoromethyl)-4-(3,5-dimethyl-1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 63736361 |
| Molecular Formula | C11H12F2N4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-(difluoromethyl)-4-(3,5-dimethyl-1,2,4-triazol-1-yl)aniline |
| SMILES | Cc1nc(C)n(-c2ccc(N)cc2C(F)F)n1 |
| InChI | InChI=1S/C11H12F2N4/c1-6-15-7(2)17(16-6)10-4-3-8(14)5-9(10)11(12)13/h3-5,11H,14H2,1-2H3 |
| InChIKey | PGWDSGWAMQUYSF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|