C16H23F2NO — CID 63736558
3-(difluoromethyl)-4-(3,3,5-trimethylcyclohexyl)oxyaniline (PubChem CID 63736558) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(3,3,5-trimethylcyclohexyl)oxyaniline.
| Compound Name | 3-(difluoromethyl)-4-(3,3,5-trimethylcyclohexyl)oxyaniline |
|---|---|
| PubChem CID | 63736558 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(difluoromethyl)-4-(3,3,5-trimethylcyclohexyl)oxyaniline |
| SMILES | CC1CC(Oc2ccc(N)cc2C(F)F)CC(C)(C)C1 |
| InChI | InChI=1S/C16H23F2NO/c1-10-6-12(9-16(2,3)8-10)20-14-5-4-11(19)7-13(14)15(17)18/h4-5,7,10,12,15H,6,8-9,19H2,1-3H3 |
| InChIKey | WDJYCRDSSRIVFY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|