About 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol
2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol (PubChem CID 63736608) has the molecular formula C6H11N3OS2
and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol.
Molecular Properties
| Compound Name | 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol |
| PubChem CID | 63736608 |
| Molecular Formula | C6H11N3OS2 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol |
| SMILES | CN(C)c1nnc(SCCO)s1 |
| InChI | InChI=1S/C6H11N3OS2/c1-9(2)5-7-8-6(12-5)11-4-3-10/h10H,3-4H2,1-2H3 |
| InChIKey | ZAKCVNGWFKFBLX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol?
The IUPAC name of 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol (CID 63736608) is 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol.
What is the SMILES notation for 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol?
The canonical SMILES for 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol is CN(C)c1nnc(SCCO)s1.
What is the InChIKey of 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol?
The InChIKey is ZAKCVNGWFKFBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS2/c1-9(2)5-7-8-6(12-5)11-4-3-10/h10H,3-4H2,1-2H3.
What are the key properties of 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol?
2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol has a molecular weight of 205.31 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanol is sourced from PubChem (CID 63736608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).