About 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol
1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol (PubChem CID 63736791) has the molecular formula C8H15N3OS2
and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol.
Molecular Properties
| Compound Name | 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol |
| PubChem CID | 63736791 |
| Molecular Formula | C8H15N3OS2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol |
| SMILES | CCC(O)CSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C8H15N3OS2/c1-4-6(12)5-13-8-10-9-7(14-8)11(2)3/h6,12H,4-5H2,1-3H3 |
| InChIKey | CTVGWIGDBFTPEV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol?
The IUPAC name of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol (CID 63736791) is 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol.
What is the SMILES notation for 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol?
The canonical SMILES for 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol is CCC(O)CSc1nnc(N(C)C)s1.
What is the InChIKey of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol?
The InChIKey is CTVGWIGDBFTPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS2/c1-4-6(12)5-13-8-10-9-7(14-8)11(2)3/h6,12H,4-5H2,1-3H3.
What are the key properties of 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol?
1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol has a molecular weight of 233.36 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-2-ol is sourced from PubChem (CID 63736791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).