C11H22N4S2 — CID 63736821
N,N-dimethyl-5-[4-(propan-2-ylamino)butylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 63736821) has the molecular formula C11H22N4S2 and a molecular weight of 274.46 g/mol. Its IUPAC name is N,N-dimethyl-5-[4-(propan-2-ylamino)butylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N,N-dimethyl-5-[4-(propan-2-ylamino)butylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 63736821 |
| Molecular Formula | C11H22N4S2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N,N-dimethyl-5-[4-(propan-2-ylamino)butylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)NCCCCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C11H22N4S2/c1-9(2)12-7-5-6-8-16-11-14-13-10(17-11)15(3)4/h9,12H,5-8H2,1-4H3 |
| InChIKey | RNAQAQMDTWETHD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|