About methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate
methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate (PubChem CID 63736986) has the molecular formula C12H22N4O2S2
and a molecular weight of 318.47 g/mol. Its IUPAC name is methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate.
Molecular Properties
| Compound Name | methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate |
| PubChem CID | 63736986 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate |
| SMILES | CNC(C)(CCCSc1nnc(N(C)C)s1)C(=O)OC |
| InChI | InChI=1S/C12H22N4O2S2/c1-12(13-2,9(17)18-5)7-6-8-19-11-15-14-10(20-11)16(3)4/h13H,6-8H2,1-5H3 |
| InChIKey | FOPQJBWFIITTEF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate?
The IUPAC name of methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate (CID 63736986) is methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate.
What is the SMILES notation for methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate?
The canonical SMILES for methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate is CNC(C)(CCCSc1nnc(N(C)C)s1)C(=O)OC.
What is the InChIKey of methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate?
The InChIKey is FOPQJBWFIITTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2S2/c1-12(13-2,9(17)18-5)7-6-8-19-11-15-14-10(20-11)16(3)4/h13H,6-8H2,1-5H3.
What are the key properties of methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate?
methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate has a molecular weight of 318.47 g/mol, XLogP of 1.63, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(methylamino)pentanoate is sourced from PubChem (CID 63736986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).