C10H10F2N4S2 — CID 63737629
5-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 63737629) has the molecular formula C10H10F2N4S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 63737629 |
| Molecular Formula | C10H10F2N4S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 5-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(Sc2c(F)cc(N)cc2F)s1 |
| InChI | InChI=1S/C10H10F2N4S2/c1-16(2)9-14-15-10(18-9)17-8-6(11)3-5(13)4-7(8)12/h3-4H,13H2,1-2H3 |
| InChIKey | AFMHIFXSNVHDBH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|