About [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate
[(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate (PubChem CID 6373766) has the molecular formula C13H15N5O3
and a molecular weight of 289.30 g/mol. Its IUPAC name is [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate |
| PubChem CID | 6373766 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C(/c2nonc2N)N(C)C)cc1 |
| InChI | InChI=1S/C13H15N5O3/c1-8-4-6-9(7-5-8)13(19)20-17-12(18(2)3)10-11(14)16-21-15-10/h4-7H,1-3H3,(H2,14,16)/b17-12- |
| InChIKey | IJWAUHCWNSXSEQ-ATVHPVEESA-N |
| XLogP | 1.04 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate?
The IUPAC name of [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate (CID 6373766) is [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate.
What is the SMILES notation for [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate?
The canonical SMILES for [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate is Cc1ccc(C(=O)O/N=C(/c2nonc2N)N(C)C)cc1.
What is the InChIKey of [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate?
The InChIKey is IJWAUHCWNSXSEQ-ATVHPVEESA-N. The full InChI is InChI=1S/C13H15N5O3/c1-8-4-6-9(7-5-8)13(19)20-17-12(18(2)3)10-11(14)16-21-15-10/h4-7H,1-3H3,(H2,14,16)/b17-12-.
What are the key properties of [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate?
[(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate has a molecular weight of 289.30 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[(4-amino-1,2,5-oxadiazol-3-yl)-(dimethylamino)methylidene]amino] 4-methylbenzoate is sourced from PubChem (CID 6373766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).