C12H16N4S2 — CID 63737804
5-[2-(2-aminophenyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 63737804) has the molecular formula C12H16N4S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 5-[2-(2-aminophenyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(2-aminophenyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 63737804 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-[2-(2-aminophenyl)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(SCCc2ccccc2N)s1 |
| InChI | InChI=1S/C12H16N4S2/c1-16(2)11-14-15-12(18-11)17-8-7-9-5-3-4-6-10(9)13/h3-6H,7-8,13H2,1-2H3 |
| InChIKey | FZQMSRUEMPAJNL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|