About [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate
[(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate (PubChem CID 6373857) has the molecular formula C16H11ClF3NO2
and a molecular weight of 341.72 g/mol. Its IUPAC name is [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate |
| PubChem CID | 6373857 |
| Molecular Formula | C16H11ClF3NO2 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate |
| SMILES | O=C(O/N=C(/Cc1ccccc1)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF3NO2/c17-13-8-6-12(7-9-13)15(22)23-21-14(16(18,19)20)10-11-4-2-1-3-5-11/h1-9H,10H2/b21-14- |
| InChIKey | ADQMZRVHYCRKKX-STZFKDTASA-N |
| XLogP | 4.66 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate?
The IUPAC name of [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate (CID 6373857) is [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate.
What is the SMILES notation for [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate?
The canonical SMILES for [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate is O=C(O/N=C(/Cc1ccccc1)C(F)(F)F)c1ccc(Cl)cc1.
What is the InChIKey of [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate?
The InChIKey is ADQMZRVHYCRKKX-STZFKDTASA-N. The full InChI is InChI=1S/C16H11ClF3NO2/c17-13-8-6-12(7-9-13)15(22)23-21-14(16(18,19)20)10-11-4-2-1-3-5-11/h1-9H,10H2/b21-14-.
What are the key properties of [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate?
[(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate has a molecular weight of 341.72 g/mol, XLogP of 4.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 4-chlorobenzoate is sourced from PubChem (CID 6373857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).