About 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide
3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide (PubChem CID 63738897) has the molecular formula C7H13N5S2
and a molecular weight of 231.35 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide.
Molecular Properties
| Compound Name | 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide |
| PubChem CID | 63738897 |
| Molecular Formula | C7H13N5S2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide |
| SMILES | [H]/N=C(\N)CCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C7H13N5S2/c1-12(2)6-10-11-7(14-6)13-4-3-5(8)9/h3-4H2,1-2H3,(H3,8,9) |
| InChIKey | DMENAYQURVGPMX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide?
The IUPAC name of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide (CID 63738897) is 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide.
What is the SMILES notation for 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide?
The canonical SMILES for 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide is [H]/N=C(\N)CCSc1nnc(N(C)C)s1.
What is the InChIKey of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide?
The InChIKey is DMENAYQURVGPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5S2/c1-12(2)6-10-11-7(14-6)13-4-3-5(8)9/h3-4H2,1-2H3,(H3,8,9).
What are the key properties of 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide?
3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide has a molecular weight of 231.35 g/mol, XLogP of 1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanimidamide is sourced from PubChem (CID 63738897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).