C18H36N2O — CID 63739412
N-[[3-[(2-ethylpiperidin-1-yl)methyl]oxan-3-yl]methyl]-2-methylpropan-2-amine (PubChem CID 63739412) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is N-[[3-[(2-ethylpiperidin-1-yl)methyl]oxan-3-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-[(2-ethylpiperidin-1-yl)methyl]oxan-3-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63739412 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | N-[[3-[(2-ethylpiperidin-1-yl)methyl]oxan-3-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCC1CCCCN1CC1(CNC(C)(C)C)CCCOC1 |
| InChI | InChI=1S/C18H36N2O/c1-5-16-9-6-7-11-20(16)14-18(10-8-12-21-15-18)13-19-17(2,3)4/h16,19H,5-15H2,1-4H3 |
| InChIKey | WBONDXGJFOHJOY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |