C16H26N2O2 — CID 63739803
N-[[3-(aminomethyl)oxan-3-yl]methyl]-1-(4-methoxyphenyl)-N-methylmethanamine (PubChem CID 63739803) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[[3-(aminomethyl)oxan-3-yl]methyl]-1-(4-methoxyphenyl)-N-methylmethanamine.
| Compound Name | N-[[3-(aminomethyl)oxan-3-yl]methyl]-1-(4-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 63739803 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-[[3-(aminomethyl)oxan-3-yl]methyl]-1-(4-methoxyphenyl)-N-methylmethanamine |
| SMILES | COc1ccc(CN(C)CC2(CN)CCCOC2)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-18(10-14-4-6-15(19-2)7-5-14)12-16(11-17)8-3-9-20-13-16/h4-7H,3,8-13,17H2,1-2H3 |
| InChIKey | GQJPDCAQDJZSPD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |